cas: 438613-29-7 — see every product listed under this CAS number, including other names
6-Bromo-3-chlorobenzo[b]thiophene-2-carboxylic acid, 95%, 95% (CAS 438613-29-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DAJR-100mg |
| cas | 438613-29-7 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 659.60 Pln | |
| Chemat | 5g | 1739.60 Pln | |
| Chemat | 10g | 2747.60 Pln | |
| Chemat | 25g | 5675.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid (CAS 438613-29-7) is a chemical compound with the molecular formula C9H4BrClO2S and a molecular weight of 291.55 g/mol. IUPAC name: 6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid. InChIKey: YTGVICLKMKCFAJ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClO2S |
|---|---|
| Molecular weight | 291.55 g/mol |
| IUPAC name | 6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | YTGVICLKMKCFAJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=C2Cl)C(=O)O |
Computed by PubChem (NCBI)