6-Bromo-3-chloro-benzo[b]thiophene-2-carboxylic acid, 97%
cas: 438613-29-7 — see every product listed under this CAS number, including other names
6-Bromo-3-chloro-benzo[b]thiophene-2-carboxylic acid, 97% (CAS 438613-29-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014591-25G |
| cas | 438613-29-7 |
| size | 25g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 5095.10 Pln | |
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 466.52 Pln | |
| Fluorochem | 5g | 1481.79 Pln | |
| Fluorochem | 10g | 2346.07 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid (CAS 438613-29-7) is a chemical compound with the molecular formula C9H4BrClO2S and a molecular weight of 291.55 g/mol. IUPAC name: 6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid. InChIKey: YTGVICLKMKCFAJ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClO2S |
|---|---|
| Molecular weight | 291.55 g/mol |
| IUPAC name | 6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | YTGVICLKMKCFAJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=C2Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid, 6-Bromo-3-chlorobenzo[b]thiophene-2-carboxylic acid, 6-bromo-3-chloro-benzo[b]thiophene-2-carboxylic acid, C9H4BrClO2S, 6-Bromo-3-chlorobenzo[b]thiophene-2-carboxylicacid, 6-bromo-3-chloro-benzothiophene-2-carboxylic acid, 3-Chloro-6-bromobenzo[b]thiophene-2-carboxylic acid, Benzo[b]thiophene-2-carboxylicacid, 6-bromo-3-chloro-, Cambridge id 7305320, 6-bromo-3-chloro-2-benzothiophenecarboxylic acid