CAS 438613-29-7 appears in our catalog under these names: 6-Bromo-3-chloro-1-benzothiophene-2-carboxylic acid, 95%, 6-Bromo-3-chlorobenzo(b)thiophene-2-carboxylic acid, 98%, 6-Bromo-3-chlorobenzo[b]thiophene-2-carboxylic acid, 95%, 95%, 6-Bromo-3-chloro-benzo[b]thiophene-2-carboxylic acid, 97%, 6-Bromo-3-chlorobenzo[b]thiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 25g.
6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid (CAS 438613-29-7) is a chemical compound with the molecular formula C9H4BrClO2S and a molecular weight of 291.55 g/mol. IUPAC name: 6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid. InChIKey: YTGVICLKMKCFAJ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClO2S |
|---|---|
| Molecular weight | 291.55 g/mol |
| IUPAC name | 6-bromo-3-chloro-1-benzothiophene-2-carboxylic acid |
| InChIKey | YTGVICLKMKCFAJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=C2Cl)C(=O)O |
Computed by PubChem (NCBI)