6-Bromo-3-chloropicolinic acid, 97%
cas: 1060815-76-0 — see every product listed under this CAS number, including other names
6-Bromo-3-chloropicolinic acid, 97% (CAS 1060815-76-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217593-250MG |
| cas | 1060815-76-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 5g | 1690.05 Pln | |
| Fluorochem | 10g | 3319.68 Pln | |
| Fluorochem | 25g | 7859.75 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-3-chloropyridine-2-carboxylic acid (CAS 1060815-76-0) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 6-bromo-3-chloropyridine-2-carboxylic acid. InChIKey: NVXKODKSZLGOCI-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 6-bromo-3-chloropyridine-2-carboxylic acid |
| InChIKey | NVXKODKSZLGOCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)C(=O)O)Br |
Computed by PubChem (NCBI)