cas: 1214328-42-3 — see every product listed under this CAS number, including other names
6-Bromo-5-chloropicolinic acid, 97% (CAS 1214328-42-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F323711-1G |
| cas | 1214328-42-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1669.22 Pln | |
| Fluorochem | 5g | 4813.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-5-chloropyridine-2-carboxylic acid (CAS 1214328-42-3) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 6-bromo-5-chloropyridine-2-carboxylic acid. InChIKey: QZGHYAQILPBFJR-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 6-bromo-5-chloropyridine-2-carboxylic acid |
| InChIKey | QZGHYAQILPBFJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)Br)C(=O)O |
Computed by PubChem (NCBI)