cas: 83472-62-2 — see every product listed under this CAS number, including other names
6-Bromo-7-chloro-3H-imidazo[4,5-b]pyridine 97% (CAS 83472-62-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A795951-250mg |
| cas | 83472-62-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2361.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A795951 |
6-bromo-7-chloro-1H-imidazo[4,5-b]pyridine (CAS 83472-62-2) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 6-bromo-7-chloro-1H-imidazo[4,5-b]pyridine. InChIKey: YZFMFJGMTUIRCK-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 6-bromo-7-chloro-1H-imidazo[4,5-b]pyridine |
| InChIKey | YZFMFJGMTUIRCK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C2C(=N1)N=CN2)Cl)Br |
Computed by PubChem (NCBI)