cas: 1258833-80-5 — see every product listed under this CAS number, including other names
6-Bromo-7-fluoroisoquinoline 95% (CAS 1258833-80-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A362781-250mg |
| cas | 1258833-80-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 987.81 Pln | |
| Ambeed | 10g | 1894.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A362781 |
6-bromo-7-fluoroisoquinoline (CAS 1258833-80-5) is a chemical compound with the molecular formula C9H5BrFN and a molecular weight of 226.04 g/mol. IUPAC name: 6-bromo-7-fluoroisoquinoline. InChIKey: SEHPXAKLMRODLS-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFN |
|---|---|
| Molecular weight | 226.04 g/mol |
| IUPAC name | 6-bromo-7-fluoroisoquinoline |
| InChIKey | SEHPXAKLMRODLS-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=CC(=C(C=C21)Br)F |
Computed by PubChem (NCBI)