cas: 1159815-57-2 — see every product listed under this CAS number, including other names
6-Bromo-8-phenylimidazo[1,2-a]pyrazine, 95%, 95% (CAS 1159815-57-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K01S-100mg |
| cas | 1159815-57-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1302.80 Pln | |
| Chemat | 250mg | 2128.40 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-8-phenylimidazo[1,2-a]pyrazine (CAS 1159815-57-2) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 6-bromo-8-phenylimidazo[1,2-a]pyrazine. InChIKey: BTNPEXCLDJWMNJ-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 6-bromo-8-phenylimidazo[1,2-a]pyrazine |
| InChIKey | BTNPEXCLDJWMNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CN3C2=NC=C3)Br |
Computed by PubChem (NCBI)