6-Bromo-9h-pyrido[2,3-b]indole, 95%
cas: 26066-88-6 — see every product listed under this CAS number, including other names
6-Bromo-9h-pyrido[2,3-b]indole, 95% (CAS 26066-88-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | HB-7815-250mg |
| cas | 26066-88-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 5g | 1257.91 Pln | |
| Fluorochem | 10g | 1830.62 Pln | |
| Fluorochem | 25g | 3538.36 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 1021.19 Pln | |
| Ambeed | 5g | 3852.50 Pln | |
| Ambeed | 25g | 13314.31 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 1097.42 Pln | |
| BLDpharm | 5g | 4151.90 Pln | |
| BLDpharm | 25g | 14353.86 Pln | |
| Fluorochem | 100mg | 242.64 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 737.26 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
6-bromo-9H-pyrido[2,3-b]indole (CAS 26066-88-6) is a chemical compound with the molecular formula C11H7BrN2 and a molecular weight of 247.09 g/mol. IUPAC name: 6-bromo-9H-pyrido[2,3-b]indole. InChIKey: XCNVELJEUIETFR-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 6-bromo-9H-pyrido[2,3-b]indole |
| InChIKey | XCNVELJEUIETFR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC3=C2C=C(C=C3)Br)N=C1 |
Computed by PubChem (NCBI)