CAS 183483-68-3 is the registry number for 7-Bromo-1H-perimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-1H-perimidine (CAS 183483-68-3) is a chemical compound with the molecular formula C11H7BrN2 and a molecular weight of 247.09 g/mol. IUPAC name: 6-bromo-1H-perimidine. InChIKey: UBYHRUYACYXJON-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 6-bromo-1H-perimidine |
| InChIKey | UBYHRUYACYXJON-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)NC=N3)Br |
Computed by PubChem (NCBI)