CAS 273213-27-7 is the registry number for 2-(2-Bromophenyl)cyclopropane-1,1-dicarbonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-(2-bromophenyl)cyclopropane-1,1-dicarbonitrile (CAS 273213-27-7) is a chemical compound with the molecular formula C11H7BrN2 and a molecular weight of 247.09 g/mol. IUPAC name: 2-(2-bromophenyl)cyclopropane-1,1-dicarbonitrile. InChIKey: DQHIEDSXOKASGC-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 2-(2-bromophenyl)cyclopropane-1,1-dicarbonitrile |
| InChIKey | DQHIEDSXOKASGC-UHFFFAOYSA-N |
| SMILES | C1C(C1(C#N)C#N)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)