CAS 2767589-78-4 is the registry number for 7-Bromo-1H-benzo[de]cinnoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
10-bromo-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene (CAS 2767589-78-4) is a chemical compound with the molecular formula C11H7BrN2 and a molecular weight of 247.09 g/mol. IUPAC name: 10-bromo-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene. InChIKey: VSYCEHWFJFGPEC-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 10-bromo-2,3-diazatricyclo[7.3.1.05,13]trideca-1(12),3,5(13),6,8,10-hexaene |
| InChIKey | VSYCEHWFJFGPEC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=CC=C3NN=C2)Br |
Computed by PubChem (NCBI)