cas: 1384265-38-6 — see every product listed under this CAS number, including other names
6-Chloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 95%, 95% (CAS 1384265-38-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110VGP-100mg |
| cas | 1384265-38-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2301.20 Pln | |
| Chemat | 1g | 4542.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1384265-38-6) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 6-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: FNDBVJRISNWNHM-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 6-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | FNDBVJRISNWNHM-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)