CAS 2250243-15-1 appears in our catalog under these names: (S)–6–Chloro–2,3–dihydrobenzofuran–3–amine hydrochloride, (S)-6-Chloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 98%, 98%, (S)-6-Chloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3S)-6-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2250243-15-1) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: (3S)-6-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: FNDBVJRISNWNHM-OGFXRTJISA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | (3S)-6-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | FNDBVJRISNWNHM-OGFXRTJISA-N |
| SMILES | C1[C@H](C2=C(O1)C=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)