cas: 886499-63-4 — see every product listed under this CAS number, including other names
6-Chloro-2-Fluoro-3-methoxybenzoyl chloride, 95+% (CAS 886499-63-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A430436-25g |
| cas | 886499-63-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 11664.31 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-chloro-2-fluoro-3-methoxybenzoyl chloride (CAS 886499-63-4) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: 6-chloro-2-fluoro-3-methoxybenzoyl chloride. InChIKey: MLQATAUZGNYEDK-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | 6-chloro-2-fluoro-3-methoxybenzoyl chloride |
| InChIKey | MLQATAUZGNYEDK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)C(=O)Cl)F |
Computed by PubChem (NCBI)