CAS 826990-47-0 appears in our catalog under these names: (3-Chloro-4-fluorophenoxy)acetyl chloride, 95%, 2-(3-Chloro-4-fluorophenoxy)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.
2-(3-chloro-4-fluorophenoxy)acetyl chloride (CAS 826990-47-0) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenoxy)acetyl chloride. InChIKey: KVZHBLKETNAFKU-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | 2-(3-chloro-4-fluorophenoxy)acetyl chloride |
| InChIKey | KVZHBLKETNAFKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(=O)Cl)Cl)F |
Computed by PubChem (NCBI)