Products 826990-47-0

CAS 826990-47-0 appears in our catalog under these names: (3-Chloro-4-fluorophenoxy)acetyl chloride, 95%, 2-(3-Chloro-4-fluorophenoxy)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

2-(3-chloro-4-fluorophenoxy)acetyl chloride (CAS 826990-47-0) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenoxy)acetyl chloride. InChIKey: KVZHBLKETNAFKU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Cl2FO2
Molecular weight223.02 g/mol
IUPAC name2-(3-chloro-4-fluorophenoxy)acetyl chloride
InChIKeyKVZHBLKETNAFKU-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1OCC(=O)Cl)Cl)F

Computed by PubChem (NCBI)