CAS 916420-71-8 is the registry number for 3,6-Dichloro-2-fluorophenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3,6-dichloro-2-fluorophenyl)acetic acid (CAS 916420-71-8) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: 2-(3,6-dichloro-2-fluorophenyl)acetic acid. InChIKey: MYZIXNBBBSGEIP-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | 2-(3,6-dichloro-2-fluorophenyl)acetic acid |
| InChIKey | MYZIXNBBBSGEIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)CC(=O)O)F)Cl |
Computed by PubChem (NCBI)