Products 916420-71-8

CAS 916420-71-8 is the registry number for 3,6-Dichloro-2-fluorophenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3,6-dichloro-2-fluorophenyl)acetic acid (CAS 916420-71-8) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: 2-(3,6-dichloro-2-fluorophenyl)acetic acid. InChIKey: MYZIXNBBBSGEIP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Cl2FO2
Molecular weight223.02 g/mol
IUPAC name2-(3,6-dichloro-2-fluorophenyl)acetic acid
InChIKeyMYZIXNBBBSGEIP-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1Cl)CC(=O)O)F)Cl

Computed by PubChem (NCBI)