Products 1279707-12-8
CAS 1279707-12-8 appears in our catalog under these names: Methyl 3,4-dichloro-2-fluorobenzoate, 95%, Methyl 3,4-dichloro-2-fluorobenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 3,4-dichloro-2-fluorobenzoate (CAS 1279707-12-8) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: methyl 3,4-dichloro-2-fluorobenzoate. InChIKey: JZBGATOVCFIEMD-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | methyl 3,4-dichloro-2-fluorobenzoate |
| InChIKey | JZBGATOVCFIEMD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Cl)Cl)F |
Computed by PubChem (NCBI)