cas: 7190-81-0 — see every product listed under this CAS number, including other names
6-Chloro-3-(4-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine, 97% (CAS 7190-81-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F678351-250MG |
| cas | 7190-81-0 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 638.33 Pln | |
| Fluorochem | 5g | 1773.35 Pln | |
| Fluorochem | 10g | 2918.78 Pln | |
| Fluorochem | 25g | 5725.09 Pln | |
| Fluorochem | 100g | 14846.87 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 1245.20 Pln | |
| Chemat | 10g | 2157.20 Pln | |
| Chemat | 25g | 4254.80 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
6-chloro-3-(4-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 7190-81-0) is a chemical compound with the molecular formula C11H6Cl2N4 and a molecular weight of 265.09 g/mol. IUPAC name: 6-chloro-3-(4-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: KKQKNWMRZMYDFM-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N4 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 6-chloro-3-(4-chlorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | KKQKNWMRZMYDFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C3N2N=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)