6-Chloro-5-methoxy-1H-indole, 98%
cas: 63762-72-1 — see every product listed under this CAS number, including other names
6-Chloro-5-methoxy-1H-indole, 98% (CAS 63762-72-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25mg, 50mg, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A117069-250mg |
| cas | 63762-72-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 1733.19 Pln | |
| Ambeed | 5g | 5254.25 Pln | |
| Chemat | 25mg | 150.80 Pln | |
| Chemat | 50mg | 208.40 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 1206.80 Pln | |
| Chemat | 5g | 3832.40 Pln | |
| Chemat | 10g | 6755.60 Pln | |
| BLDpharm | 100mg | 364.34 Pln | |
| BLDpharm | 250mg | 569.82 Pln | |
| BLDpharm | 1g | 1863.81 Pln | |
| BLDpharm | 5g | 5662.48 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
6-chloro-5-methoxy-1H-indole (CAS 63762-72-1) is a chemical compound with the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. IUPAC name: 6-chloro-5-methoxy-1H-indole. InChIKey: SSBPRGFEADRKDA-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 6-chloro-5-methoxy-1H-indole |
| InChIKey | SSBPRGFEADRKDA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CN2)Cl |
Computed by PubChem (NCBI)