cas: 845306-05-0 — see every product listed under this CAS number, including other names
6-Chloro-N,N-dimethylpicolinamide 96% (CAS 845306-05-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A865590-250mg |
| cas | 845306-05-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1460.62 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A865590 |
6-chloro-N,N-dimethylpyridine-2-carboxamide (CAS 845306-05-0) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 6-chloro-N,N-dimethylpyridine-2-carboxamide. InChIKey: CNCWTWVWSPMBLK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 6-chloro-N,N-dimethylpyridine-2-carboxamide |
| InChIKey | CNCWTWVWSPMBLK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NC(=CC=C1)Cl |
Computed by PubChem (NCBI)