cas: 1247996-69-5 — see every product listed under this CAS number, including other names
6-Chloro-N-(cyclopropylmethyl)-2-pyridinecarboxamide, 95-<97% (CAS 1247996-69-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1928-95-97-5g |
| cas | 1247996-69-5 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 5833.08 Pln | |
| Hoffman Fine Chemicals | 10g | 9144.30 Pln | |
| Hoffman Fine Chemicals | 25g | 17986.98 Pln | |
| Hoffman Fine Chemicals | 50g | 28590.54 Pln | |
| Hoffman Fine Chemicals | 100g | 48387.68 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
6-chloro-N-(cyclopropylmethyl)pyridine-2-carboxamide (CAS 1247996-69-5) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 6-chloro-N-(cyclopropylmethyl)pyridine-2-carboxamide. InChIKey: RFLBQSUYIQMXSF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 6-chloro-N-(cyclopropylmethyl)pyridine-2-carboxamide |
| InChIKey | RFLBQSUYIQMXSF-UHFFFAOYSA-N |
| SMILES | C1CC1CNC(=O)C2=NC(=CC=C2)Cl |
Computed by PubChem (NCBI)