CAS 33105-95-2 is the registry number for (2-Phenyl-1,3-oxazol-4-yl)methanamine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-phenyl-1,3-oxazol-4-yl)methanamine;hydrochloride (CAS 33105-95-2) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: (2-phenyl-1,3-oxazol-4-yl)methanamine;hydrochloride. InChIKey: RWLTYFKPYDABFQ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | (2-phenyl-1,3-oxazol-4-yl)methanamine;hydrochloride |
| InChIKey | RWLTYFKPYDABFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CO2)CN.Cl |
Computed by PubChem (NCBI)