cas: 4377-63-3 — see every product listed under this CAS number, including other names
6-Chlorochroman-2-one 97% (CAS 4377-63-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A416318-100mg |
| cas | 4377-63-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1115.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A416318 |
6-chloro-3,4-dihydrochromen-2-one (CAS 4377-63-3) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 6-chloro-3,4-dihydrochromen-2-one. InChIKey: KKMNLXQACWRZHQ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 6-chloro-3,4-dihydrochromen-2-one |
| InChIKey | KKMNLXQACWRZHQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)OC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)