6-Cyclohexyl-4-methyl-2H-pyran-2-one 97%
cas: 14818-35-0 — see every product listed under this CAS number, including other names
6-Cyclohexyl-4-methyl-2H-pyran-2-one 97% (CAS 14818-35-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150176-5g |
| cas | 14818-35-0 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 542.81 Pln | |
| Ambeed | 500g | 1616.38 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A150176 |
6-cyclohexyl-4-methylpyran-2-one (CAS 14818-35-0) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 6-cyclohexyl-4-methylpyran-2-one. InChIKey: GPKRKAFTZYODFF-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 6-cyclohexyl-4-methylpyran-2-one |
| InChIKey | GPKRKAFTZYODFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC(=C1)C2CCCCC2 |
Computed by PubChem (NCBI)
Synonyms:
6-Cyclohexyl-4-methyl-2H-pyran-2-one, 2H-Pyran-2-one, 6-cyclohexyl-4-methyl-, Ciclopirox olamine impurity B [EP], Ciclopirox olamine specified impurity B [EP], CICLOPIROX IMPURITY B [EP IMPURITY], CICLOPIROX OLAMINE IMPURITY B [EP IMPURITY], CICLOPIROX IMPURITY B (EP IMPURITY), CICLOPIROX OLAMINE IMPURITY B (EP IMPURITY), Ciclopirox olamine impurity B, Ciclopirox olamine specified impurity B