Products 14818-35-0
CAS 14818-35-0 appears in our catalog under these names: Ciclopirox Impurity B, 6-Cyclohexyl-4-methyl-2H-pyran-2-one, Ciclopirox EP Impurity B, 6–Cyclohexyl–4–methyl–2H–pyran–2–one, 6-Cyclohexyl-4-methyl-2H-pyran-2-one 97%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Ambeed. Available pack sizes: on request, 100mg, 1g, 25mg, 25g, 5g, 100g, 500g.
6-cyclohexyl-4-methylpyran-2-one (CAS 14818-35-0) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 6-cyclohexyl-4-methylpyran-2-one. InChIKey: GPKRKAFTZYODFF-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 6-cyclohexyl-4-methylpyran-2-one |
| InChIKey | GPKRKAFTZYODFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC(=C1)C2CCCCC2 |
Computed by PubChem (NCBI)
Synonyms:
6-Cyclohexyl-4-methyl-2H-pyran-2-one, 2H-Pyran-2-one, 6-cyclohexyl-4-methyl-, Ciclopirox olamine impurity B [EP], Ciclopirox olamine specified impurity B [EP], CICLOPIROX IMPURITY B [EP IMPURITY], CICLOPIROX OLAMINE IMPURITY B [EP IMPURITY], CICLOPIROX IMPURITY B (EP IMPURITY), CICLOPIROX OLAMINE IMPURITY B (EP IMPURITY), Ciclopirox olamine impurity B, Ciclopirox olamine specified impurity B