cas: 697739-05-2 — see every product listed under this CAS number, including other names
6-FLUORO-4-INDAZOLECARBOXYLIC ACID METHYL ESTER, 97% (CAS 697739-05-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F794508-100MG |
| cas | 697739-05-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 570.65 Pln | |
| Fluorochem | 250mg | 909.07 Pln | |
| Fluorochem | 500mg | 1263.11 Pln | |
| Fluorochem | 1g | 1851.45 Pln | |
| Fluorochem | 5g | 5402.28 Pln | |
| Fluorochem | 10g | 8953.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 6-fluoro-1H-indazole-4-carboxylate (CAS 697739-05-2) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: methyl 6-fluoro-1H-indazole-4-carboxylate. InChIKey: HLNVECDTQXVGPS-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | methyl 6-fluoro-1H-indazole-4-carboxylate |
| InChIKey | HLNVECDTQXVGPS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=NNC2=CC(=C1)F |
Computed by PubChem (NCBI)