CAS 697739-05-2 appears in our catalog under these names: 6-Fluoro-4-indazolecarboxylic acid methyl ester, 95%, methyl 6-fluoro-1H-indazole-4-carboxylate, 97%, 97%, 6-FLUORO-4-INDAZOLECARBOXYLIC ACID METHYL ESTER, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g, 10g.
Methyl 6-fluoro-1H-indazole-4-carboxylate (CAS 697739-05-2) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: methyl 6-fluoro-1H-indazole-4-carboxylate. InChIKey: HLNVECDTQXVGPS-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | methyl 6-fluoro-1H-indazole-4-carboxylate |
| InChIKey | HLNVECDTQXVGPS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=NNC2=CC(=C1)F |
Computed by PubChem (NCBI)