CAS 697739-07-4 appears in our catalog under these names: 6-Fluoro-1-methyl-1h-indazole-4-carboxylic acid, 95%, 6-Fluoro-1-methyl-1H-indazole-4-carboxylic acid, 97%, 6–Fluoro–1–methyl–1H–indazole–4–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 100mg, 1g.
6-fluoro-1-methylindazole-4-carboxylic acid (CAS 697739-07-4) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: 6-fluoro-1-methylindazole-4-carboxylic acid. InChIKey: OKPNNCCYWIRQFX-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | 6-fluoro-1-methylindazole-4-carboxylic acid |
| InChIKey | OKPNNCCYWIRQFX-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=CC(=C2C=N1)C(=O)O)F |
Computed by PubChem (NCBI)