CAS 1027530-64-8 is the registry number for 5-Fluoro-7-azaindole-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate (CAS 1027530-64-8) is a chemical compound with the molecular formula C9H7FN2O2 and a molecular weight of 194.16 g/mol. IUPAC name: methyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate. InChIKey: SDFAOMSNGRJZID-UHFFFAOYSA-N.
| Molecular formula | C9H7FN2O2 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | methyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate |
| InChIKey | SDFAOMSNGRJZID-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=C1C=C(C=N2)F |
Computed by PubChem (NCBI)