cas: 220844-73-5 — see every product listed under this CAS number, including other names
6-FLUOROQUINOLINE-4-CARBOXYLIC ACID, 96% (CAS 220844-73-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305771-100MG |
| cas | 220844-73-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 500mg | 622.72 Pln | |
| Fluorochem | 1g | 893.45 Pln | |
| Fluorochem | 5g | 4246.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
6-fluoroquinoline-4-carboxylic acid (CAS 220844-73-5) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 6-fluoroquinoline-4-carboxylic acid. InChIKey: FNGWSJQERDIOJO-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 6-fluoroquinoline-4-carboxylic acid |
| InChIKey | FNGWSJQERDIOJO-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C=C1F)C(=O)O |
Computed by PubChem (NCBI)