CAS 1807542-81-9 is the registry number for 3-Fluoroquinoline-8-carboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
3-fluoroquinoline-8-carboxylic acid (CAS 1807542-81-9) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 3-fluoroquinoline-8-carboxylic acid. InChIKey: ZFLUVYREXQUUNH-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 3-fluoroquinoline-8-carboxylic acid |
| InChIKey | ZFLUVYREXQUUNH-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)C(=O)O)F |
Computed by PubChem (NCBI)