CAS 6633-22-3 appears in our catalog under these names: 1-(4-Fluoro-phenyl)-pyrrole-2,5-dione, 95%, N-(4-Fluorophenyl)maleimide, >98.0%(GC), 1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione 98%, 1-(4-Fluorophenyl)-1H-pyrrole-2,5-dione, 98%, 98%, 1-(4-Fluorophenyl)-pyrrole-2,5-dione, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 200mg, 250mg, 50mg, 100mg, 10g.
1-(4-fluorophenyl)pyrrole-2,5-dione (CAS 6633-22-3) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 1-(4-fluorophenyl)pyrrole-2,5-dione. InChIKey: SBKKXWSZVVDOLR-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 1-(4-fluorophenyl)pyrrole-2,5-dione |
| InChIKey | SBKKXWSZVVDOLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)F |
Computed by PubChem (NCBI)