Products 734524-15-3
CAS 734524-15-3 appears in our catalog under these names: 7–Fluoroquinoline–3–carboxylic acid, 7-Fluoroquinoline-3-carboxylic acid, 95%, 7-Fluoroquinoline-3-carboxylic acid 95%, 7-FLUOROQUINOLINE-3-CARBOXYLIC ACID, 97%, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
7-fluoroquinoline-3-carboxylic acid (CAS 734524-15-3) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 7-fluoroquinoline-3-carboxylic acid. InChIKey: PXJCGANFXZBADU-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 7-fluoroquinoline-3-carboxylic acid |
| InChIKey | PXJCGANFXZBADU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)C(=O)O)F |
Computed by PubChem (NCBI)