CAS 105300-40-1 appears in our catalog under these names: 6-Fluoro-4-oxochroman-2-carboxylic acid, 95%, Nebivolol Impurity 42, 6-Fluoro-4-oxochroman-2-carboxylic acid, 95+%, 6-Fluoro-4-oxochroman-2-carboxylic acid, 95+%, 95+%, 6-Fluoro-4-oxo-3,4-dihydro-2h-1-benzopyran-2-carboxylic acid, 95+%. Offered by: Combi-blocks, Chemat Brand, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, on request, 5g.
6-fluoro-4-oxo-2,3-dihydrochromene-2-carboxylic acid (CAS 105300-40-1) is a chemical compound with the molecular formula C10H7FO4 and a molecular weight of 210.16 g/mol. IUPAC name: 6-fluoro-4-oxo-2,3-dihydrochromene-2-carboxylic acid. InChIKey: BWXXHZKFLLLJQP-UHFFFAOYSA-N.
| Molecular formula | C10H7FO4 |
|---|---|
| Molecular weight | 210.16 g/mol |
| IUPAC name | 6-fluoro-4-oxo-2,3-dihydrochromene-2-carboxylic acid |
| InChIKey | BWXXHZKFLLLJQP-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(C1=O)C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)