CAS 1312135-86-6 is the registry number for 6-Fluoro-1-oxoisochroman-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid (CAS 1312135-86-6) is a chemical compound with the molecular formula C10H7FO4 and a molecular weight of 210.16 g/mol. IUPAC name: 6-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid. InChIKey: ULGXENVTSRRYGN-UHFFFAOYSA-N.
| Molecular formula | C10H7FO4 |
|---|---|
| Molecular weight | 210.16 g/mol |
| IUPAC name | 6-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid |
| InChIKey | ULGXENVTSRRYGN-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)C2=C1C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)