Products 1380317-47-4

CAS 1380317-47-4 is the registry number for 5-Carboxy-2-fluorocinnamic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[(E)-2-carboxyethenyl]-4-fluorobenzoic acid (CAS 1380317-47-4) is a chemical compound with the molecular formula C10H7FO4 and a molecular weight of 210.16 g/mol. IUPAC name: 3-[(E)-2-carboxyethenyl]-4-fluorobenzoic acid. InChIKey: QKVADZLSLLXTDY-DUXPYHPUSA-N.

Identity
Molecular formulaC10H7FO4
Molecular weight210.16 g/mol
IUPAC name3-[(E)-2-carboxyethenyl]-4-fluorobenzoic acid
InChIKeyQKVADZLSLLXTDY-DUXPYHPUSA-N
SMILESC1=CC(=C(C=C1C(=O)O)/C=C/C(=O)O)F

Computed by PubChem (NCBI)