CAS 1601177-71-2 appears in our catalog under these names: 7-Fluoro-1-oxo-3,4-dihydro-1H-2-benzopyran-3-carboxylic acid, 95%, 7-Fluoro-1-oxo-3,4-dihydro-1H-2-benzopyran-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid (CAS 1601177-71-2) is a chemical compound with the molecular formula C10H7FO4 and a molecular weight of 210.16 g/mol. IUPAC name: 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid. InChIKey: GFOSNMAGOIQQRL-UHFFFAOYSA-N.
| Molecular formula | C10H7FO4 |
|---|---|
| Molecular weight | 210.16 g/mol |
| IUPAC name | 7-fluoro-1-oxo-3,4-dihydroisochromene-3-carboxylic acid |
| InChIKey | GFOSNMAGOIQQRL-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)C2=C1C=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)