6-Fluoroimidazo[1,2-a]pyridine-2-carboxylic acid, 97%
cas: 367500-94-5 — see every product listed under this CAS number, including other names
6-Fluoroimidazo[1,2-a]pyridine-2-carboxylic acid, 97% (CAS 367500-94-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F044081-250MG |
| cas | 367500-94-5 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 2044.09 Pln | |
| Fluorochem | 5g | 7208.94 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| Ambeed | 5g | 2612.06 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1053.20 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 758.65 Pln | |
| BLDpharm | 5g | 2807.92 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
6-fluoroimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 367500-94-5) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 6-fluoroimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: ZZRCDROTHZQIGY-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 6-fluoroimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | ZZRCDROTHZQIGY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1F)C(=O)O |
Computed by PubChem (NCBI)