CAS 88145-90-8 appears in our catalog under these names: 6-Fluoroquinazoline-2,4-diol, 98%, 98%, 2,4-Dihydroxy-6-fluoroquinazoline, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
6-fluoro-1H-quinazoline-2,4-dione (CAS 88145-90-8) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 6-fluoro-1H-quinazoline-2,4-dione. InChIKey: QUQJMNPJMVUMNE-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 6-fluoro-1H-quinazoline-2,4-dione |
| InChIKey | QUQJMNPJMVUMNE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)