cas: 502651-65-2 — see every product listed under this CAS number, including other names
6-Isopropyl-3H-thieno[2,3-d]pyrimidin-4-one, 98%, 98% (CAS 502651-65-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9UK-5g |
| cas | 502651-65-2 |
| size | 5g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 8037.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-propan-2-yl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 502651-65-2) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 6-propan-2-yl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: QPXYXDJHZOFGTB-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 6-propan-2-yl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | QPXYXDJHZOFGTB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(S1)N=CNC2=O |
Computed by PubChem (NCBI)