cas: 202807-44-1 — see every product listed under this CAS number, including other names
6-Methoxy-1-methyl-1H-indole-3-carbaldehyde, 98% (CAS 202807-44-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F058852-1G |
| cas | 202807-44-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 1226.67 Pln | |
| Fluorochem | 10g | 2403.34 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-methoxy-1-methylindole-3-carbaldehyde (CAS 202807-44-1) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 6-methoxy-1-methylindole-3-carbaldehyde. InChIKey: WRHNJAIUBFJMEM-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 6-methoxy-1-methylindole-3-carbaldehyde |
| InChIKey | WRHNJAIUBFJMEM-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=C(C=C2)OC)C=O |
Computed by PubChem (NCBI)