cas: 691900-59-1 — see every product listed under this CAS number, including other names
6-Methoxy-1H-indazole-3-carbonitrile 98% (CAS 691900-59-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A775709-1g |
| cas | 691900-59-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 954.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A775709 |
6-methoxy-1H-indazole-3-carbonitrile (CAS 691900-59-1) is a chemical compound with the molecular formula C9H7N3O and a molecular weight of 173.17 g/mol. IUPAC name: 6-methoxy-1H-indazole-3-carbonitrile. InChIKey: QAJXYNLOGLGDCG-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 6-methoxy-1H-indazole-3-carbonitrile |
| InChIKey | QAJXYNLOGLGDCG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=NN2)C#N |
Computed by PubChem (NCBI)