cas: 58596-37-5 — see every product listed under this CAS number, including other names
6-Methoxy-2-methylquinolin-4(1H)-one, 98%, 98% (CAS 58596-37-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBDK-1g |
| cas | 58596-37-5 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 592.40 Pln | |
| Chemat | 25g | 1912.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-2-methyl-1H-quinolin-4-one (CAS 58596-37-5) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 6-methoxy-2-methyl-1H-quinolin-4-one. InChIKey: JEFIWGFOCYLOLA-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 6-methoxy-2-methyl-1H-quinolin-4-one |
| InChIKey | JEFIWGFOCYLOLA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C=CC(=C2)OC |
Computed by PubChem (NCBI)