cas: 82788-18-9 — see every product listed under this CAS number, including other names
6-Methoxy-3-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester, 98% (CAS 82788-18-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867617-100MG |
| cas | 82788-18-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 440.49 Pln | |
| Fluorochem | 250mg | 695.61 Pln | |
| Fluorochem | 1g | 1705.67 Pln | |
| Fluorochem | 5g | 7953.47 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 6-methoxy-3-methyl-1-benzothiophene-2-carboxylate (CAS 82788-18-9) is a chemical compound with the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. IUPAC name: methyl 6-methoxy-3-methyl-1-benzothiophene-2-carboxylate. InChIKey: DXTARBMTXWMXBE-UHFFFAOYSA-N.
| Molecular formula | C12H12O3S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | methyl 6-methoxy-3-methyl-1-benzothiophene-2-carboxylate |
| InChIKey | DXTARBMTXWMXBE-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=CC(=C2)OC)C(=O)OC |
Computed by PubChem (NCBI)