CAS 934555-21-2 is the registry number for Spiro[cyclobutane-1,2'-thiochroman]-4'-one 1',1'-dioxide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-dioxospiro[3H-thiochromene-2,1'-cyclobutane]-4-one (CAS 934555-21-2) is a chemical compound with the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. IUPAC name: 1,1-dioxospiro[3H-thiochromene-2,1'-cyclobutane]-4-one. InChIKey: YJHAPWGZNRQSAV-UHFFFAOYSA-N.
| Molecular formula | C12H12O3S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 1,1-dioxospiro[3H-thiochromene-2,1'-cyclobutane]-4-one |
| InChIKey | YJHAPWGZNRQSAV-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(=O)C3=CC=CC=C3S2(=O)=O |
Computed by PubChem (NCBI)