CAS 82788-18-9 appears in our catalog under these names: 6-Methoxy-3-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester, 95%, 6-Methoxy-3-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester 97%, 6-Methoxy-3-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester, 97%, 97%, 6-Methoxy-3-methyl-benzo[b]thiophene-2-carboxylic acid methyl ester, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 6-methoxy-3-methyl-1-benzothiophene-2-carboxylate (CAS 82788-18-9) is a chemical compound with the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. IUPAC name: methyl 6-methoxy-3-methyl-1-benzothiophene-2-carboxylate. InChIKey: DXTARBMTXWMXBE-UHFFFAOYSA-N.
| Molecular formula | C12H12O3S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | methyl 6-methoxy-3-methyl-1-benzothiophene-2-carboxylate |
| InChIKey | DXTARBMTXWMXBE-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=CC(=C2)OC)C(=O)OC |
Computed by PubChem (NCBI)