Products 1597410-42-8
CAS 1597410-42-8 is the registry number for (E)-S-Methyl 4-(4-methoxyphenyl)-2-oxobut-3-enethioate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
S-methyl (E)-4-(4-methoxyphenyl)-2-oxobut-3-enethioate (CAS 1597410-42-8) is a chemical compound with the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. IUPAC name: S-methyl (E)-4-(4-methoxyphenyl)-2-oxobut-3-enethioate. InChIKey: VGLDKXXFBDHOHI-VMPITWQZSA-N.
| Molecular formula | C12H12O3S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | S-methyl (E)-4-(4-methoxyphenyl)-2-oxobut-3-enethioate |
| InChIKey | VGLDKXXFBDHOHI-VMPITWQZSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C(=O)C(=O)SC |
Computed by PubChem (NCBI)