cas: 26149-11-1 — see every product listed under this CAS number, including other names
6-Methoxy-3-nitropyridin-2-ol 97% (CAS 26149-11-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A355419-1g |
| cas | 26149-11-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 503.88 Pln | |
| Ambeed | 25g | 1149.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A355419 |
6-methoxy-3-nitro-1H-pyridin-2-one (CAS 26149-11-1) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 6-methoxy-3-nitro-1H-pyridin-2-one. InChIKey: RYLKVLKLMVFOBM-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 6-methoxy-3-nitro-1H-pyridin-2-one |
| InChIKey | RYLKVLKLMVFOBM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)