cas: 94166-62-8 — see every product listed under this CAS number, including other names
6-Methoxypyridine-2,3-diamine dihydrochloride 98% (CAS 94166-62-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A395607-100mg |
| cas | 94166-62-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1644.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A395607 |
6-methoxypyridine-2,3-diamine;dihydrochloride (CAS 94166-62-8) is a chemical compound with the molecular formula C6H11Cl2N3O and a molecular weight of 212.07 g/mol. IUPAC name: 6-methoxypyridine-2,3-diamine;dihydrochloride. InChIKey: HFTXXPTXSCLIIP-UHFFFAOYSA-N.
| Molecular formula | C6H11Cl2N3O |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 6-methoxypyridine-2,3-diamine;dihydrochloride |
| InChIKey | HFTXXPTXSCLIIP-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)